C22H20F5N5O — CID 169027534
4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]prop-2-enyl]amino]-6-[1-(difluoromethyl)cyclopropyl]-2-methylpyrido[4,3-d]pyrimidin-7-one (PubChem CID 169027534) has the molecular formula C22H20F5N5O and a molecular weight of 465.43 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]prop-2-enyl]amino]-6-[1-(difluoromethyl)cyclopropyl]-2-methylpyrido[4,3-d]pyrimidin-7-one.
| Compound Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]prop-2-enyl]amino]-6-[1-(difluoromethyl)cyclopropyl]-2-methylpyrido[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 169027534 |
| Molecular Formula | C22H20F5N5O |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-[[(1R)-1-[3-amino-5-(trifluoromethyl)phenyl]prop-2-enyl]amino]-6-[1-(difluoromethyl)cyclopropyl]-2-methylpyrido[4,3-d]pyrimidin-7-one |
| SMILES | C=C[C@@H](Nc1nc(C)nc2cc(=O)n(C3(C(F)F)CC3)cc12)c1cc(N)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F5N5O/c1-3-16(12-6-13(22(25,26)27)8-14(28)7-12)31-19-15-10-32(21(4-5-21)20(23)24)18(33)9-17(15)29-11(2)30-19/h3,6-10,16,20H,1,4-5,28H2,2H3,(H,29,30,31)/t16-/m1/s1 |
| InChIKey | QLDGGJPUGHMOSG-MRXNPFEDSA-N |
| XLogP | 4.79 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|