C18H21N3O7S — CID 169032066
methyl (E)-5-[6-[(3-methyloxetan-3-yl)sulfamoyl]-2,4-dioxo-1H-quinazolin-3-yl]pent-2-enoate (PubChem CID 169032066) has the molecular formula C18H21N3O7S and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl (E)-5-[6-[(3-methyloxetan-3-yl)sulfamoyl]-2,4-dioxo-1H-quinazolin-3-yl]pent-2-enoate.
| Compound Name | methyl (E)-5-[6-[(3-methyloxetan-3-yl)sulfamoyl]-2,4-dioxo-1H-quinazolin-3-yl]pent-2-enoate |
|---|---|
| PubChem CID | 169032066 |
| Molecular Formula | C18H21N3O7S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl (E)-5-[6-[(3-methyloxetan-3-yl)sulfamoyl]-2,4-dioxo-1H-quinazolin-3-yl]pent-2-enoate |
| SMILES | COC(=O)/C=C/CCn1c(=O)[nH]c2ccc(S(=O)(=O)NC3(C)COC3)cc2c1=O |
| InChI | InChI=1S/C18H21N3O7S/c1-18(10-28-11-18)20-29(25,26)12-6-7-14-13(9-12)16(23)21(17(24)19-14)8-4-3-5-15(22)27-2/h3,5-7,9,20H,4,8,10-11H2,1-2H3,(H,19,24)/b5-3+ |
| InChIKey | XSRPVCSBOSRCQW-HWKANZROSA-N |
| XLogP | -0.12 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|