C13H22N2O3 — CID 169045886
methyl 3-[(3-aminocyclopentanecarbonyl)amino]cyclopentane-1-carboxylate (PubChem CID 169045886) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl 3-[(3-aminocyclopentanecarbonyl)amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 3-[(3-aminocyclopentanecarbonyl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 169045886 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | methyl 3-[(3-aminocyclopentanecarbonyl)amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)C2CCC(N)C2)C1 |
| InChI | InChI=1S/C13H22N2O3/c1-18-13(17)9-3-5-11(7-9)15-12(16)8-2-4-10(14)6-8/h8-11H,2-7,14H2,1H3,(H,15,16) |
| InChIKey | KMLBWKNXLRCNOQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |