C22H31N3O3 — CID 169048317
N,N-diethyl-5,5a-dihydroxy-7-propyl-4,5,6,6a,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 169048317) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N,N-diethyl-5,5a-dihydroxy-7-propyl-4,5,6,6a,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | N,N-diethyl-5,5a-dihydroxy-7-propyl-4,5,6,6a,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 169048317 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N,N-diethyl-5,5a-dihydroxy-7-propyl-4,5,6,6a,8,9-hexahydroindolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCN1CC(C(=O)N(CC)CC)C=C2c3cccc4c3C(O)(CC21)C(O)N4 |
| InChI | InChI=1S/C22H31N3O3/c1-4-10-25-13-14(20(26)24(5-2)6-3)11-16-15-8-7-9-17-19(15)22(28,12-18(16)25)21(27)23-17/h7-9,11,14,18,21,23,27-28H,4-6,10,12-13H2,1-3H3 |
| InChIKey | YAISBHSDQSGOBF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |