C21H27N3O — CID 176977745
(4R)-N,N-diethyl-6,11-dimethyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide (PubChem CID 176977745) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (4R)-N,N-diethyl-6,11-dimethyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide.
| Compound Name | (4R)-N,N-diethyl-6,11-dimethyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 176977745 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (4R)-N,N-diethyl-6,11-dimethyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,10,12(16),13-pentaene-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cccc4c(C)cn(c34)CC2N(C)C1 |
| InChI | InChI=1S/C21H27N3O/c1-5-23(6-2)21(25)15-10-18-17-9-7-8-16-14(3)11-24(20(16)17)13-19(18)22(4)12-15/h7-11,15,19H,5-6,12-13H2,1-4H3/t15-,19?/m1/s1 |
| InChIKey | ZLKPRCQSEPTQPA-NYRJJRHWSA-N |
| XLogP | 3.15 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |