C20H24ClN3O — CID 176977727
(4R,7S)-14-chloro-N,N-diethyl-6-methyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,10,12,14-pentaene-4-carboxamide (PubChem CID 176977727) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is (4R,7S)-14-chloro-N,N-diethyl-6-methyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,10,12,14-pentaene-4-carboxamide.
| Compound Name | (4R,7S)-14-chloro-N,N-diethyl-6-methyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,10,12,14-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 176977727 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (4R,7S)-14-chloro-N,N-diethyl-6-methyl-6,9-diazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(16),2,10,12,14-pentaene-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1C=C2c3cc(Cl)cc4ccn(c34)C[C@H]2N(C)C1 |
| InChI | InChI=1S/C20H24ClN3O/c1-4-23(5-2)20(25)14-9-16-17-10-15(21)8-13-6-7-24(19(13)17)12-18(16)22(3)11-14/h6-10,14,18H,4-5,11-12H2,1-3H3/t14-,18-/m1/s1 |
| InChIKey | OSGGQRYKEPTFPT-RDTXWAMCSA-N |
| XLogP | 3.49 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |