C47H40N2 — CID 169048450
2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine (PubChem CID 169048450) has the molecular formula C47H40N2 and a molecular weight of 636.88 g/mol. Its IUPAC name is 2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine.
| Compound Name | 2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine |
|---|---|
| PubChem CID | 169048450 |
| Molecular Formula | C47H40N2 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | 2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]-4-(5,6,7,8-tetrahydronaphthalen-2-yl)pyridine |
| SMILES | [2H]C([2H])(c1ccc(-c2ccccn2)cc1)C([2H])([2H])c1cc(C)cc(-c2ccccc2-c2ccc(-c3cc(-c4ccc5c(c4)CCCC5)ccn3)cc2)c1 |
| InChI | InChI=1S/C47H40N2/c1-33-28-35(14-13-34-15-17-38(18-16-34)46-12-6-7-26-48-46)30-43(29-33)45-11-5-4-10-44(45)37-20-22-39(23-21-37)47-32-42(25-27-49-47)41-24-19-36-8-2-3-9-40(36)31-41/h4-7,10-12,15-32H,2-3,8-9,13-14H2,1H3/i13D2,14D2 |
| InChIKey | YLFHBDKCGMBPLV-RYIWKTDQSA-N |
| XLogP | 11.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |