C52H50N2 — CID 169048458
4-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]pyridine (PubChem CID 169048458) has the molecular formula C52H50N2 and a molecular weight of 707.01 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]pyridine.
| Compound Name | 4-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 169048458 |
| Molecular Formula | C52H50N2 |
| Molecular Weight | 707.01 g/mol |
| Exact Mass | 706.42 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-[4-[2-[3-methyl-5-[1,1,2,2-tetradeuterio-2-(4-pyridin-2-ylphenyl)ethyl]phenyl]phenyl]phenyl]pyridine |
| SMILES | [2H]C([2H])(c1ccc(-c2ccccn2)cc1)C([2H])([2H])c1cc(C)cc(-c2ccccc2-c2ccc(-c3cc(-c4ccc5c(c4)C(C)(C)C(C)(C)C5(C)C)ccn3)cc2)c1 |
| InChI | InChI=1S/C52H50N2/c1-35-30-37(16-15-36-17-19-39(20-18-36)48-14-10-11-28-53-48)32-43(31-35)45-13-9-8-12-44(45)38-21-23-40(24-22-38)49-34-42(27-29-54-49)41-25-26-46-47(33-41)51(4,5)52(6,7)50(46,2)3/h8-14,17-34H,15-16H2,1-7H3/i15D2,16D2 |
| InChIKey | OIESCJQYUZKUNC-ONNKGWAKSA-N |
| XLogP | 13.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.01 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |