C17H24N6O2 — CID 169052087
methyl 1-[3-amino-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]triazole-4-carboxylate (PubChem CID 169052087) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl 1-[3-amino-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[3-amino-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 169052087 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl 1-[3-amino-4-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2ccc(N3C[C@@H](C)N(C)[C@@H](C)C3)c(N)c2)nn1 |
| InChI | InChI=1S/C17H24N6O2/c1-11-8-22(9-12(2)21(11)3)16-6-5-13(7-14(16)18)23-10-15(19-20-23)17(24)25-4/h5-7,10-12H,8-9,18H2,1-4H3/t11-,12+ |
| InChIKey | AFUNAVAMWPLCPD-TXEJJXNPSA-N |
| XLogP | 1.16 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|