C19H20ClN3O2 — CID 169053126
N-[5-chloro-2-cyano-4-[2-(3-hydroxypropylamino)ethyl]phenyl]benzamide (PubChem CID 169053126) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[5-chloro-2-cyano-4-[2-(3-hydroxypropylamino)ethyl]phenyl]benzamide.
| Compound Name | N-[5-chloro-2-cyano-4-[2-(3-hydroxypropylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 169053126 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[5-chloro-2-cyano-4-[2-(3-hydroxypropylamino)ethyl]phenyl]benzamide |
| SMILES | N#Cc1cc(CCNCCCO)c(Cl)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20ClN3O2/c20-17-12-18(23-19(25)14-5-2-1-3-6-14)16(13-21)11-15(17)7-9-22-8-4-10-24/h1-3,5-6,11-12,22,24H,4,7-10H2,(H,23,25) |
| InChIKey | MYEKBHILVYVFQR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|