C22H32N4O4Si — CID 169054050
3-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-(hydroxymethyl)-3-pyridinyl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylic acid (PubChem CID 169054050) has the molecular formula C22H32N4O4Si and a molecular weight of 444.61 g/mol. Its IUPAC name is 3-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-(hydroxymethyl)-3-pyridinyl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylic acid.
| Compound Name | 3-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-(hydroxymethyl)-3-pyridinyl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 169054050 |
| Molecular Formula | C22H32N4O4Si |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-[[6-(3-azabicyclo[3.1.0]hexan-3-yl)-2-(hydroxymethyl)-3-pyridinyl]methyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(Cc2ccc(N3CC4CC4C3)nc2CO)cc1C(=O)O |
| InChI | InChI=1S/C22H32N4O4Si/c1-31(2,3)7-6-30-14-26-20(22(28)29)10-18(24-26)9-15-4-5-21(23-19(15)13-27)25-11-16-8-17(16)12-25/h4-5,10,16-17,27H,6-9,11-14H2,1-3H3,(H,28,29) |
| InChIKey | NICXGNQSPCNNNR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|