C29H20FN5O — CID 169055275
N-[2-fluoro-5-(pyridin-4-ylamino)phenyl]-4-[(7-isocyanonaphthalen-1-yl)amino]benzamide (PubChem CID 169055275) has the molecular formula C29H20FN5O and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[2-fluoro-5-(pyridin-4-ylamino)phenyl]-4-[(7-isocyanonaphthalen-1-yl)amino]benzamide.
| Compound Name | N-[2-fluoro-5-(pyridin-4-ylamino)phenyl]-4-[(7-isocyanonaphthalen-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 169055275 |
| Molecular Formula | C29H20FN5O |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | N-[2-fluoro-5-(pyridin-4-ylamino)phenyl]-4-[(7-isocyanonaphthalen-1-yl)amino]benzamide |
| SMILES | [C-]#[N+]c1ccc2cccc(Nc3ccc(C(=O)Nc4cc(Nc5ccncc5)ccc4F)cc3)c2c1 |
| InChI | InChI=1S/C29H20FN5O/c1-31-23-10-5-19-3-2-4-27(25(19)17-23)34-21-8-6-20(7-9-21)29(36)35-28-18-24(11-12-26(28)30)33-22-13-15-32-16-14-22/h2-18,34H,(H,32,33)(H,35,36) |
| InChIKey | HKXHBUGFNINAPO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|