About [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate
[2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate (PubChem CID 169057613) has the molecular formula C23H44O5
and a molecular weight of 400.60 g/mol. Its IUPAC name is [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate.
Molecular Properties
| Compound Name | [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate |
| PubChem CID | 169057613 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate |
| SMILES | CCCCC(C)(C)CC(=O)OCC(C)(CO)COC(=O)CC(C)(C)CCCC |
| InChI | InChI=1S/C23H44O5/c1-8-10-12-21(3,4)14-19(25)27-17-23(7,16-24)18-28-20(26)15-22(5,6)13-11-9-2/h24H,8-18H2,1-7H3 |
| InChIKey | IJFJFDXTEUZTCZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate?
The IUPAC name of [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate (CID 169057613) is [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate.
What is the SMILES notation for [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate?
The canonical SMILES for [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate is CCCCC(C)(C)CC(=O)OCC(C)(CO)COC(=O)CC(C)(C)CCCC.
What is the InChIKey of [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate?
The InChIKey is IJFJFDXTEUZTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44O5/c1-8-10-12-21(3,4)14-19(25)27-17-23(7,16-24)18-28-20(26)15-22(5,6)13-11-9-2/h24H,8-18H2,1-7H3.
What are the key properties of [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate?
[2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate has a molecular weight of 400.60 g/mol, XLogP of 5.28, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,3-dimethylheptanoyloxymethyl)-3-hydroxy-2-methylpropyl] 3,3-dimethylheptanoate is sourced from PubChem (CID 169057613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).