C30H26BNO3 — CID 169059372
1,3,4,5,6,8-hexadeuterio-9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]carbazole (PubChem CID 169059372) has the molecular formula C30H26BNO3 and a molecular weight of 465.39 g/mol. Its IUPAC name is 1,3,4,5,6,8-hexadeuterio-9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]carbazole.
| Compound Name | 1,3,4,5,6,8-hexadeuterio-9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]carbazole |
|---|---|
| PubChem CID | 169059372 |
| Molecular Formula | C30H26BNO3 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 1,3,4,5,6,8-hexadeuterio-9-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]carbazole |
| SMILES | [2H]c1cc([2H])c2c(c1[2H])c1c([2H])c([2H])cc([2H])c1n2-c1cccc2c1oc1cc(B3OC(C)(C)C(C)(C)O3)ccc12 |
| InChI | InChI=1S/C30H26BNO3/c1-29(2)30(3,4)35-31(34-29)19-16-17-22-23-12-9-15-26(28(23)33-27(22)18-19)32-24-13-7-5-10-20(24)21-11-6-8-14-25(21)32/h5-18H,1-4H3/i5D,6D,10D,11D,13D,14D |
| InChIKey | GGVRCCLGFYUGRM-WRPOWHSSSA-N |
| XLogP | 6.98 |
| TPSA | 36.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|