C23H26N6O — CID 169060358
7,11-bis[(4-aminophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one (PubChem CID 169060358) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 7,11-bis[(4-aminophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one.
| Compound Name | 7,11-bis[(4-aminophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
|---|---|
| PubChem CID | 169060358 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 7,11-bis[(4-aminophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
| SMILES | Nc1ccc(CN2CCC3=C(C2)C(=O)N(Cc2ccc(N)cc2)C2=NCCN23)cc1 |
| InChI | InChI=1S/C23H26N6O/c24-18-5-1-16(2-6-18)13-27-11-9-21-20(15-27)22(30)29(23-26-10-12-28(21)23)14-17-3-7-19(25)8-4-17/h1-8H,9-15,24-25H2 |
| InChIKey | QBLAAQPSJGUAIC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|