C23H21F3N4O — CID 169060377
11-[(3,4-difluorophenyl)methyl]-7-[(4-fluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one (PubChem CID 169060377) has the molecular formula C23H21F3N4O and a molecular weight of 426.44 g/mol. Its IUPAC name is 11-[(3,4-difluorophenyl)methyl]-7-[(4-fluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one.
| Compound Name | 11-[(3,4-difluorophenyl)methyl]-7-[(4-fluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
|---|---|
| PubChem CID | 169060377 |
| Molecular Formula | C23H21F3N4O |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 11-[(3,4-difluorophenyl)methyl]-7-[(4-fluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
| SMILES | O=C1C2=C(CCN(Cc3ccc(F)c(F)c3)C2)N2CCN=C2N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H21F3N4O/c24-17-4-1-15(2-5-17)13-30-22(31)18-14-28(12-16-3-6-19(25)20(26)11-16)9-7-21(18)29-10-8-27-23(29)30/h1-6,11H,7-10,12-14H2 |
| InChIKey | BMGKRHIEBUMQEB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |