C24H23ClF2N4O2 — CID 169060264
7-[1-(4-chlorophenyl)-2-hydroxyethyl]-11-[(3,5-difluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one (PubChem CID 169060264) has the molecular formula C24H23ClF2N4O2 and a molecular weight of 472.92 g/mol. Its IUPAC name is 7-[1-(4-chlorophenyl)-2-hydroxyethyl]-11-[(3,5-difluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one.
| Compound Name | 7-[1-(4-chlorophenyl)-2-hydroxyethyl]-11-[(3,5-difluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
|---|---|
| PubChem CID | 169060264 |
| Molecular Formula | C24H23ClF2N4O2 |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 7-[1-(4-chlorophenyl)-2-hydroxyethyl]-11-[(3,5-difluorophenyl)methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
| SMILES | O=C1C2=C(CCN(Cc3cc(F)cc(F)c3)C2)N2CCN=C2N1C(CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClF2N4O2/c25-17-3-1-16(2-4-17)22(14-32)31-23(33)20-13-29(12-15-9-18(26)11-19(27)10-15)7-5-21(20)30-8-6-28-24(30)31/h1-4,9-11,22,32H,5-8,12-14H2 |
| InChIKey | AGRICDWQHQHIGV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |