C24H21F4N7O — CID 169060276
11-[(3-azidophenyl)methyl]-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one (PubChem CID 169060276) has the molecular formula C24H21F4N7O and a molecular weight of 499.47 g/mol. Its IUPAC name is 11-[(3-azidophenyl)methyl]-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one.
| Compound Name | 11-[(3-azidophenyl)methyl]-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
|---|---|
| PubChem CID | 169060276 |
| Molecular Formula | C24H21F4N7O |
| Molecular Weight | 499.47 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 11-[(3-azidophenyl)methyl]-7-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2,5,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),5-dien-8-one |
| SMILES | [N-]=[N+]=Nc1cccc(CN2CCC3=C(C2)C(=O)N(Cc2ccc(C(F)(F)F)c(F)c2)C2=NCCN23)c1 |
| InChI | InChI=1S/C24H21F4N7O/c25-20-11-16(4-5-19(20)24(26,27)28)13-35-22(36)18-14-33(8-6-21(18)34-9-7-30-23(34)35)12-15-2-1-3-17(10-15)31-32-29/h1-5,10-11H,6-9,12-14H2 |
| InChIKey | PUBAFEAVJSCEIH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|