C29H27F3N4O — CID 154694377
5-[(3-but-3-en-1-ynylphenyl)methyl]-9-[[4-(trifluoromethyl)phenyl]methyl]-1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-dien-8-one (PubChem CID 154694377) has the molecular formula C29H27F3N4O and a molecular weight of 504.56 g/mol. Its IUPAC name is 5-[(3-but-3-en-1-ynylphenyl)methyl]-9-[[4-(trifluoromethyl)phenyl]methyl]-1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-dien-8-one.
| Compound Name | 5-[(3-but-3-en-1-ynylphenyl)methyl]-9-[[4-(trifluoromethyl)phenyl]methyl]-1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-dien-8-one |
|---|---|
| PubChem CID | 154694377 |
| Molecular Formula | C29H27F3N4O |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 5-[(3-but-3-en-1-ynylphenyl)methyl]-9-[[4-(trifluoromethyl)phenyl]methyl]-1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-dien-8-one |
| SMILES | C=CC#Cc1cccc(CN2CCC3=C(C2)C(=O)N(Cc2ccc(C(F)(F)F)cc2)C2=NCCCN23)c1 |
| InChI | InChI=1S/C29H27F3N4O/c1-2-3-6-21-7-4-8-23(17-21)18-34-16-13-26-25(20-34)27(37)36(28-33-14-5-15-35(26)28)19-22-9-11-24(12-10-22)29(30,31)32/h2,4,7-12,17H,1,5,13-16,18-20H2 |
| InChIKey | HZVZDIUJPHTWHL-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|