C13H15N5O — CID 169061240
(3R)-4-[4-(isocyanomethyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine (PubChem CID 169061240) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is (3R)-4-[4-(isocyanomethyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[4-(isocyanomethyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 169061240 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (3R)-4-[4-(isocyanomethyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine |
| SMILES | [C-]#[N+]Cc1cc(N2CCOC[C@H]2C)nn2cncc12 |
| InChI | InChI=1S/C13H15N5O/c1-10-8-19-4-3-17(10)13-5-11(6-14-2)12-7-15-9-18(12)16-13/h5,7,9-10H,3-4,6,8H2,1H3/t10-/m1/s1 |
| InChIKey | XBFPQKKVTDXDLE-SNVBAGLBSA-N |
| XLogP | 1.37 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|