C18H23N5O — CID 169061177
(3R)-4-[4-(1-isocyanocyclohexyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine (PubChem CID 169061177) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (3R)-4-[4-(1-isocyanocyclohexyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine.
| Compound Name | (3R)-4-[4-(1-isocyanocyclohexyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 169061177 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (3R)-4-[4-(1-isocyanocyclohexyl)imidazo[1,5-b]pyridazin-2-yl]-3-methylmorpholine |
| SMILES | [C-]#[N+]C1(c2cc(N3CCOC[C@H]3C)nn3cncc23)CCCCC1 |
| InChI | InChI=1S/C18H23N5O/c1-14-12-24-9-8-22(14)17-10-15(16-11-20-13-23(16)21-17)18(19-2)6-4-3-5-7-18/h10-11,13-14H,3-9,12H2,1H3/t14-/m1/s1 |
| InChIKey | MQUMEMCYSLPQNA-CQSZACIVSA-N |
| XLogP | 3.03 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|