C31H46F2N2O6Si2 — CID 169068228
3-benzoyl-1-[(2R,3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyclopropyl-3-fluorooxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 169068228) has the molecular formula C31H46F2N2O6Si2 and a molecular weight of 636.89 g/mol. Its IUPAC name is 3-benzoyl-1-[(2R,3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyclopropyl-3-fluorooxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-[(2R,3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyclopropyl-3-fluorooxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 169068228 |
| Molecular Formula | C31H46F2N2O6Si2 |
| Molecular Weight | 636.89 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | 3-benzoyl-1-[(2R,3S,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-cyclopropyl-3-fluorooxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C2CC2)O[C@@H](n2cc(F)c(=O)n(C(=O)c3ccccc3)c2=O)[C@@H](F)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H46F2N2O6Si2/c1-29(2,3)42(7,8)39-19-31(21-16-17-21)24(41-43(9,10)30(4,5)6)23(33)27(40-31)34-18-22(32)26(37)35(28(34)38)25(36)20-14-12-11-13-15-20/h11-15,18,21,23-24,27H,16-17,19H2,1-10H3/t23-,24-,27+,31-/m0/s1 |
| InChIKey | NNQQAQFAESFAQI-VLXHMQPOSA-N |
| XLogP | 6.27 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|