C43H30N2 — CID 169070986
2-ethyl-1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphthalen-1-yl]benzimidazole (PubChem CID 169070986) has the molecular formula C43H30N2 and a molecular weight of 589.82 g/mol. Its IUPAC name is 2-ethyl-1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphthalen-1-yl]benzimidazole.
| Compound Name | 2-ethyl-1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphthalen-1-yl]benzimidazole |
|---|---|
| PubChem CID | 169070986 |
| Molecular Formula | C43H30N2 |
| Molecular Weight | 589.82 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | 2-ethyl-1-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(1,3,4,5,6,7,8-heptadeuterionaphthalen-2-yl)anthracen-9-yl]naphthalen-1-yl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4ccc(-n5c(CC)nc6ccccc65)c5ccccc45)c4c([2H])c([2H])c([2H])c([2H])c34)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C43H30N2/c1-2-41-44-38-21-11-12-22-40(38)45(41)39-26-25-37(31-15-5-6-16-32(31)39)43-35-19-9-7-17-33(35)42(34-18-8-10-20-36(34)43)30-24-23-28-13-3-4-14-29(28)27-30/h3-27H,2H2,1H3/i3D,4D,7D,8D,9D,10D,13D,14D,17D,18D,19D,20D,23D,24D,27D |
| InChIKey | HOYIFHAMBJWECB-SJMJSLJNSA-N |
| XLogP | 11.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.82 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|