C39H26N2 — CID 169071230
2-ethyl-1-(1,2,3,4,5,6,7,8-octadeuterio-10-fluoranthen-3-ylanthracen-9-yl)benzimidazole (PubChem CID 169071230) has the molecular formula C39H26N2 and a molecular weight of 530.70 g/mol. Its IUPAC name is 2-ethyl-1-(1,2,3,4,5,6,7,8-octadeuterio-10-fluoranthen-3-ylanthracen-9-yl)benzimidazole.
| Compound Name | 2-ethyl-1-(1,2,3,4,5,6,7,8-octadeuterio-10-fluoranthen-3-ylanthracen-9-yl)benzimidazole |
|---|---|
| PubChem CID | 169071230 |
| Molecular Formula | C39H26N2 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-ethyl-1-(1,2,3,4,5,6,7,8-octadeuterio-10-fluoranthen-3-ylanthracen-9-yl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-n3c(CC)nc4ccccc43)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc4c5c(cccc35)-c3ccccc3-4)c2c1[2H] |
| InChI | InChI=1S/C39H26N2/c1-2-36-40-34-20-9-10-21-35(34)41(36)39-32-16-7-5-14-28(32)38(29-15-6-8-17-33(29)39)31-23-22-30-25-13-4-3-12-24(25)26-18-11-19-27(31)37(26)30/h3-23H,2H2,1H3/i5D,6D,7D,8D,14D,15D,16D,17D |
| InChIKey | XHWYOTFERYFMAZ-GXPGWNOSSA-N |
| XLogP | 10.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|