C24H33N3O3S — CID 16907251
2,4-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide (PubChem CID 16907251) has the molecular formula C24H33N3O3S and a molecular weight of 443.61 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16907251 |
| Molecular Formula | C24H33N3O3S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2,4-dimethyl-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(c2ccc3c(c2)CCCN3C)N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C24H33N3O3S/c1-18-6-9-24(19(2)15-18)31(28,29)25-17-23(27-11-13-30-14-12-27)21-7-8-22-20(16-21)5-4-10-26(22)3/h6-9,15-16,23,25H,4-5,10-14,17H2,1-3H3 |
| InChIKey | SDHWXRUVGKIWDS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|