C25H35N3O4S — CID 30578352
2-methoxy-4,5-dimethyl-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide (PubChem CID 30578352) has the molecular formula C25H35N3O4S and a molecular weight of 473.64 g/mol. Its IUPAC name is 2-methoxy-4,5-dimethyl-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide.
| Compound Name | 2-methoxy-4,5-dimethyl-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30578352 |
| Molecular Formula | C25H35N3O4S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 2-methoxy-4,5-dimethyl-N-[(2S)-2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-morpholin-4-ylethyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(C)cc1S(=O)(=O)NC[C@H](c1ccc2c(c1)CCCN2C)N1CCOCC1 |
| InChI | InChI=1S/C25H35N3O4S/c1-18-14-24(31-4)25(15-19(18)2)33(29,30)26-17-23(28-10-12-32-13-11-28)21-7-8-22-20(16-21)6-5-9-27(22)3/h7-8,14-16,23,26H,5-6,9-13,17H2,1-4H3/t23-/m1/s1 |
| InChIKey | KWVVUTUMVXKQGC-HSZRJFAPSA-N |
| XLogP | 3.05 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|