C24H32N4O4S — CID 16907748
N-[3-methyl-4-[[2-(1-methyl-2,3-dihydroindol-5-yl)-2-morpholin-4-ylethyl]sulfamoyl]phenyl]acetamide (PubChem CID 16907748) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[3-methyl-4-[[2-(1-methyl-2,3-dihydroindol-5-yl)-2-morpholin-4-ylethyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-methyl-4-[[2-(1-methyl-2,3-dihydroindol-5-yl)-2-morpholin-4-ylethyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 16907748 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[3-methyl-4-[[2-(1-methyl-2,3-dihydroindol-5-yl)-2-morpholin-4-ylethyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(c2ccc3c(c2)CCN3C)N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-17-14-21(26-18(2)29)5-7-24(17)33(30,31)25-16-23(28-10-12-32-13-11-28)19-4-6-22-20(15-19)8-9-27(22)3/h4-7,14-15,23,25H,8-13,16H2,1-3H3,(H,26,29) |
| InChIKey | FOVFLCXTBIENCA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|