C11H15BN4O3 — CID 169077559
(2-methyl-8-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)boronic acid (PubChem CID 169077559) has the molecular formula C11H15BN4O3 and a molecular weight of 262.08 g/mol. Its IUPAC name is (2-methyl-8-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)boronic acid.
| Compound Name | (2-methyl-8-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)boronic acid |
|---|---|
| PubChem CID | 169077559 |
| Molecular Formula | C11H15BN4O3 |
| Molecular Weight | 262.08 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2-methyl-8-morpholin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-7-yl)boronic acid |
| SMILES | Cc1nc2c(N3CCOCC3)c(B(O)O)ccn2n1 |
| InChI | InChI=1S/C11H15BN4O3/c1-8-13-11-10(15-4-6-19-7-5-15)9(12(17)18)2-3-16(11)14-8/h2-3,17-18H,4-7H2,1H3 |
| InChIKey | WFLSLZOSPADVLJ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.08 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|