C53H57NO2 — CID 169078188
3',5,6',11,17-pentatert-butylspiro[1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-22,9'-fluorene]-8,14-dione (PubChem CID 169078188) has the molecular formula C53H57NO2 and a molecular weight of 740.04 g/mol. Its IUPAC name is 3',5,6',11,17-pentatert-butylspiro[1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-22,9'-fluorene]-8,14-dione.
| Compound Name | 3',5,6',11,17-pentatert-butylspiro[1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-22,9'-fluorene]-8,14-dione |
|---|---|
| PubChem CID | 169078188 |
| Molecular Formula | C53H57NO2 |
| Molecular Weight | 740.04 g/mol |
| Exact Mass | 739.44 |
| IUPAC Name | 3',5,6',11,17-pentatert-butylspiro[1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene-22,9'-fluorene]-8,14-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)ccc1C21c2cc(C(C)(C)C)cc3c(=O)c4cc(C(C)(C)C)cc5c(=O)c6cc(C(C)(C)C)cc1c6n(c23)c45 |
| InChI | InChI=1S/C53H57NO2/c1-48(2,3)28-16-18-39-33(20-28)34-21-29(49(4,5)6)17-19-40(34)53(39)41-26-31(51(10,11)12)24-37-44(41)54-43-35(46(37)55)22-30(50(7,8)9)23-36(43)47(56)38-25-32(52(13,14)15)27-42(53)45(38)54/h16-27H,1-15H3 |
| InChIKey | KCROEMWYHQCPLE-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.04 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|