C16H21BrN2O4 — CID 169080766
methyl 4-[[(2S)-2-bromobutanoyl]amino]-3-[[(2S)-oxetan-2-yl]methylamino]benzoate (PubChem CID 169080766) has the molecular formula C16H21BrN2O4 and a molecular weight of 385.26 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-bromobutanoyl]amino]-3-[[(2S)-oxetan-2-yl]methylamino]benzoate.
| Compound Name | methyl 4-[[(2S)-2-bromobutanoyl]amino]-3-[[(2S)-oxetan-2-yl]methylamino]benzoate |
|---|---|
| PubChem CID | 169080766 |
| Molecular Formula | C16H21BrN2O4 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | methyl 4-[[(2S)-2-bromobutanoyl]amino]-3-[[(2S)-oxetan-2-yl]methylamino]benzoate |
| SMILES | CC[C@H](Br)C(=O)Nc1ccc(C(=O)OC)cc1NC[C@@H]1CCO1 |
| InChI | InChI=1S/C16H21BrN2O4/c1-3-12(17)15(20)19-13-5-4-10(16(21)22-2)8-14(13)18-9-11-6-7-23-11/h4-5,8,11-12,18H,3,6-7,9H2,1-2H3,(H,19,20)/t11-,12-/m0/s1 |
| InChIKey | LXJIOPDQMLFIOT-RYUDHWBXSA-N |
| XLogP | 2.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|