C13H16N2O5 — CID 138466067
methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate (PubChem CID 138466067) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate.
| Compound Name | methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate |
|---|---|
| PubChem CID | 138466067 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate |
| SMILES | COC(=O)c1ccc(NC[C@@H]2COCCO2)c(N=O)c1 |
| InChI | InChI=1S/C13H16N2O5/c1-18-13(16)9-2-3-11(12(6-9)15-17)14-7-10-8-19-4-5-20-10/h2-3,6,10,14H,4-5,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | RDUMGCBKGQDIKW-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |