About methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate
methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate (PubChem CID 138466067) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate.
Molecular Properties
| Compound Name | methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate |
| PubChem CID | 138466067 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate |
| SMILES | COC(=O)c1ccc(NC[C@@H]2COCCO2)c(N=O)c1 |
| InChI | InChI=1S/C13H16N2O5/c1-18-13(16)9-2-3-11(12(6-9)15-17)14-7-10-8-19-4-5-20-10/h2-3,6,10,14H,4-5,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | RDUMGCBKGQDIKW-SNVBAGLBSA-N |
| XLogP | 1.70 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate?
The IUPAC name of methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate (CID 138466067) is methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate.
What is the SMILES notation for methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate?
The canonical SMILES for methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate is COC(=O)c1ccc(NC[C@@H]2COCCO2)c(N=O)c1.
What is the InChIKey of methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate?
The InChIKey is RDUMGCBKGQDIKW-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H16N2O5/c1-18-13(16)9-2-3-11(12(6-9)15-17)14-7-10-8-19-4-5-20-10/h2-3,6,10,14H,4-5,7-8H2,1H3/t10-/m1/s1.
What are the key properties of methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate?
methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate has a molecular weight of 280.28 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(2R)-1,4-dioxan-2-yl]methylamino]-3-nitrosobenzoate is sourced from PubChem (CID 138466067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).