C13H12Cl3NO6 — CID 169081252
methyl 4-[2-oxo-2-(2,2,2-trichloroethoxycarbonylamino)oxyethyl]benzoate (PubChem CID 169081252) has the molecular formula C13H12Cl3NO6 and a molecular weight of 384.60 g/mol. Its IUPAC name is methyl 4-[2-oxo-2-(2,2,2-trichloroethoxycarbonylamino)oxyethyl]benzoate.
| Compound Name | methyl 4-[2-oxo-2-(2,2,2-trichloroethoxycarbonylamino)oxyethyl]benzoate |
|---|---|
| PubChem CID | 169081252 |
| Molecular Formula | C13H12Cl3NO6 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | methyl 4-[2-oxo-2-(2,2,2-trichloroethoxycarbonylamino)oxyethyl]benzoate |
| SMILES | COC(=O)c1ccc(CC(=O)ONC(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C13H12Cl3NO6/c1-21-11(19)9-4-2-8(3-5-9)6-10(18)23-17-12(20)22-7-13(14,15)16/h2-5H,6-7H2,1H3,(H,17,20) |
| InChIKey | SCNSUMMIIKCCSF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|