C12H6F8S — CID 169082627
4,4,5,5,6,6,7,7-octafluoro-3H-dibenzothiophene (PubChem CID 169082627) has the molecular formula C12H6F8S and a molecular weight of 334.23 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7-octafluoro-3H-dibenzothiophene.
| Compound Name | 4,4,5,5,6,6,7,7-octafluoro-3H-dibenzothiophene |
|---|---|
| PubChem CID | 169082627 |
| Molecular Formula | C12H6F8S |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 4,4,5,5,6,6,7,7-octafluoro-3H-dibenzothiophene |
| SMILES | FC1(F)CC=CC2=C1S(F)(F)C1=C2C=CC(F)(F)C1(F)F |
| InChI | InChI=1S/C12H6F8S/c13-10(14)4-1-2-6-7-3-5-11(15,16)12(17,18)9(7)21(19,20)8(6)10/h1-3,5H,4H2 |
| InChIKey | YAJFKEHJVZMNLI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|