C13H10F3S+ — CID 163342340
5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium (PubChem CID 163342340) has the molecular formula C13H10F3S+ and a molecular weight of 255.28 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium.
| Compound Name | 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium |
|---|---|
| PubChem CID | 163342340 |
| Molecular Formula | C13H10F3S+ |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-(trifluoromethyl)-1,7-dihydrodibenzothiophen-5-ium |
| SMILES | FC(F)(F)[s+]1c2c(c3c1=CC=CC3)C=CCC=2 |
| InChI | InChI=1S/C13H10F3S/c14-13(15,16)17-11-7-3-1-5-9(11)10-6-2-4-8-12(10)17/h1-3,6-8H,4-5H2/q+1 |
| InChIKey | UQCPTLPIICZCIB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|