C22H29N3O4 — CID 169083439
tert-butyl N-[(2S)-1-(2-amino-5-phenoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 169083439) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-amino-5-phenoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-amino-5-phenoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 169083439 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-amino-5-phenoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1cc(Oc2ccccc2)ccc1N |
| InChI | InChI=1S/C22H29N3O4/c1-14(2)19(25-21(27)29-22(3,4)5)20(26)24-18-13-16(11-12-17(18)23)28-15-9-7-6-8-10-15/h6-14,19H,23H2,1-5H3,(H,24,26)(H,25,27)/t19-/m0/s1 |
| InChIKey | BTHAIORZJPOWGI-IBGZPJMESA-N |
| XLogP | 4.55 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|