C14H22NO3P — CID 169084802
butan-2-yl-(3-hydroxyimino-1-phenylbutyl)phosphinic acid (PubChem CID 169084802) has the molecular formula C14H22NO3P and a molecular weight of 283.31 g/mol. Its IUPAC name is butan-2-yl-(3-hydroxyimino-1-phenylbutyl)phosphinic acid.
| Compound Name | butan-2-yl-(3-hydroxyimino-1-phenylbutyl)phosphinic acid |
|---|---|
| PubChem CID | 169084802 |
| Molecular Formula | C14H22NO3P |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | butan-2-yl-(3-hydroxyimino-1-phenylbutyl)phosphinic acid |
| SMILES | CCC(C)P(=O)(O)C(CC(C)=NO)c1ccccc1 |
| InChI | InChI=1S/C14H22NO3P/c1-4-12(3)19(17,18)14(10-11(2)15-16)13-8-6-5-7-9-13/h5-9,12,14,16H,4,10H2,1-3H3,(H,17,18) |
| InChIKey | ZXQKPSFCQOGYPM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|