C13H20NO3P — CID 169084814
(3-hydroxyimino-1-phenylbutyl)-propan-2-ylphosphinic acid (PubChem CID 169084814) has the molecular formula C13H20NO3P and a molecular weight of 269.28 g/mol. Its IUPAC name is (3-hydroxyimino-1-phenylbutyl)-propan-2-ylphosphinic acid.
| Compound Name | (3-hydroxyimino-1-phenylbutyl)-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 169084814 |
| Molecular Formula | C13H20NO3P |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (3-hydroxyimino-1-phenylbutyl)-propan-2-ylphosphinic acid |
| SMILES | CC(CC(c1ccccc1)P(=O)(O)C(C)C)=NO |
| InChI | InChI=1S/C13H20NO3P/c1-10(2)18(16,17)13(9-11(3)14-15)12-7-5-4-6-8-12/h4-8,10,13,15H,9H2,1-3H3,(H,16,17) |
| InChIKey | WXGUIVMXPUEICV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|