C24H33N7O5S — CID 169085734
tert-butyl N-[(2S)-1-[[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-1,3-thiazol-2-yl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate (PubChem CID 169085734) has the molecular formula C24H33N7O5S and a molecular weight of 531.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-1,3-thiazol-2-yl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-1,3-thiazol-2-yl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 169085734 |
| Molecular Formula | C24H33N7O5S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[4-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]-1,3-thiazol-2-yl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate |
| SMILES | COC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1nc(-c2cc3c(N4C[C@@H](C)O[C@@H](C)C4)ncnn3c2)cs1 |
| InChI | InChI=1S/C24H33N7O5S/c1-14-8-30(9-15(2)35-14)20-19-7-16(10-31(19)26-13-25-20)18-12-37-22(27-18)29-21(32)17(11-34-6)28-23(33)36-24(3,4)5/h7,10,12-15,17H,8-9,11H2,1-6H3,(H,28,33)(H,27,29,32)/t14-,15+,17-/m0/s1 |
| InChIKey | KQYBEKWRHHYJOE-UXLLHSPISA-N |
| XLogP | 2.94 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |