C39H51P3 — CID 169086026
[1-[2,3-bis(2,2-dimethyl-1-phenylphosphanylpropyl)phenyl]-2,2-dimethylpropyl]-phenylphosphane (PubChem CID 169086026) has the molecular formula C39H51P3 and a molecular weight of 612.76 g/mol. Its IUPAC name is [1-[2,3-bis(2,2-dimethyl-1-phenylphosphanylpropyl)phenyl]-2,2-dimethylpropyl]-phenylphosphane.
| Compound Name | [1-[2,3-bis(2,2-dimethyl-1-phenylphosphanylpropyl)phenyl]-2,2-dimethylpropyl]-phenylphosphane |
|---|---|
| PubChem CID | 169086026 |
| Molecular Formula | C39H51P3 |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.32 |
| IUPAC Name | [1-[2,3-bis(2,2-dimethyl-1-phenylphosphanylpropyl)phenyl]-2,2-dimethylpropyl]-phenylphosphane |
| SMILES | CC(C)(C)C(Pc1ccccc1)c1cccc(C(Pc2ccccc2)C(C)(C)C)c1C(Pc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H51P3/c1-37(2,3)34(40-28-20-13-10-14-21-28)31-26-19-27-32(35(38(4,5)6)41-29-22-15-11-16-23-29)33(31)36(39(7,8)9)42-30-24-17-12-18-25-30/h10-27,34-36,40-42H,1-9H3 |
| InChIKey | SMOVOMTZLKVTIL-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|