C16H19FN2O3 — CID 169087846
methyl 7-(7-fluoro-4-oxo-3H-quinazolin-2-yl)heptanoate (PubChem CID 169087846) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is methyl 7-(7-fluoro-4-oxo-3H-quinazolin-2-yl)heptanoate.
| Compound Name | methyl 7-(7-fluoro-4-oxo-3H-quinazolin-2-yl)heptanoate |
|---|---|
| PubChem CID | 169087846 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | methyl 7-(7-fluoro-4-oxo-3H-quinazolin-2-yl)heptanoate |
| SMILES | COC(=O)CCCCCCc1nc2cc(F)ccc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H19FN2O3/c1-22-15(20)7-5-3-2-4-6-14-18-13-10-11(17)8-9-12(13)16(21)19-14/h8-10H,2-7H2,1H3,(H,18,19,21) |
| InChIKey | IRFIVILUUJDKFD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|