C28H38BrN3O2SSi — CID 169088932
6-bromo-8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine (PubChem CID 169088932) has the molecular formula C28H38BrN3O2SSi and a molecular weight of 588.69 g/mol. Its IUPAC name is 6-bromo-8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine.
| Compound Name | 6-bromo-8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 169088932 |
| Molecular Formula | C28H38BrN3O2SSi |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | 6-bromo-8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine |
| SMILES | CSCc1cccc(Nc2ncc3cc(Br)cc(OC4CCC(O[Si](C)(C)C(C)(C)C)CC4)c3n2)c1 |
| InChI | InChI=1S/C28H38BrN3O2SSi/c1-28(2,3)36(5,6)34-24-12-10-23(11-13-24)33-25-16-21(29)15-20-17-30-27(32-26(20)25)31-22-9-7-8-19(14-22)18-35-4/h7-9,14-17,23-24H,10-13,18H2,1-6H3,(H,30,31,32) |
| InChIKey | XHCGZUOMZWMFEM-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|