C32H45ClN4O3SSi — CID 169088960
8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-chloro-N-[3-(methylsulfanylmethyl)-4-morpholin-4-ylphenyl]quinazolin-2-amine (PubChem CID 169088960) has the molecular formula C32H45ClN4O3SSi and a molecular weight of 629.34 g/mol. Its IUPAC name is 8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-chloro-N-[3-(methylsulfanylmethyl)-4-morpholin-4-ylphenyl]quinazolin-2-amine.
| Compound Name | 8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-chloro-N-[3-(methylsulfanylmethyl)-4-morpholin-4-ylphenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 169088960 |
| Molecular Formula | C32H45ClN4O3SSi |
| Molecular Weight | 629.34 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-chloro-N-[3-(methylsulfanylmethyl)-4-morpholin-4-ylphenyl]quinazolin-2-amine |
| SMILES | CSCc1cc(Nc2ncc3ccc(Cl)c(OC4CCC(O[Si](C)(C)C(C)(C)C)CC4)c3n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C32H45ClN4O3SSi/c1-32(2,3)42(5,6)40-26-11-9-25(10-12-26)39-30-27(33)13-7-22-20-34-31(36-29(22)30)35-24-8-14-28(23(19-24)21-41-4)37-15-17-38-18-16-37/h7-8,13-14,19-20,25-26H,9-12,15-18,21H2,1-6H3,(H,34,35,36) |
| InChIKey | IRWNCORRPDPZAO-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.34 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|