C28H38FN3O2SSi — CID 169088957
8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-fluoro-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine (PubChem CID 169088957) has the molecular formula C28H38FN3O2SSi and a molecular weight of 527.78 g/mol. Its IUPAC name is 8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-fluoro-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine.
| Compound Name | 8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-fluoro-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 169088957 |
| Molecular Formula | C28H38FN3O2SSi |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 8-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]oxy-7-fluoro-N-[3-(methylsulfanylmethyl)phenyl]quinazolin-2-amine |
| SMILES | CSCc1cccc(Nc2ncc3ccc(F)c(OC4CCC(O[Si](C)(C)C(C)(C)C)CC4)c3n2)c1 |
| InChI | InChI=1S/C28H38FN3O2SSi/c1-28(2,3)36(5,6)34-23-13-11-22(12-14-23)33-26-24(29)15-10-20-17-30-27(32-25(20)26)31-21-9-7-8-19(16-21)18-35-4/h7-10,15-17,22-23H,11-14,18H2,1-6H3,(H,30,31,32) |
| InChIKey | WFOHRKZXXKPMKW-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|