C5H4Cl4O — CID 169090019
2,2,2-trichloro-1-(1-chlorocyclopropyl)ethanone (PubChem CID 169090019) has the molecular formula C5H4Cl4O and a molecular weight of 221.90 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(1-chlorocyclopropyl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(1-chlorocyclopropyl)ethanone |
|---|---|
| PubChem CID | 169090019 |
| Molecular Formula | C5H4Cl4O |
| Molecular Weight | 221.90 g/mol |
| Exact Mass | 219.90 |
| IUPAC Name | 2,2,2-trichloro-1-(1-chlorocyclopropyl)ethanone |
| SMILES | O=C(C(Cl)(Cl)Cl)C1(Cl)CC1 |
| InChI | InChI=1S/C5H4Cl4O/c6-4(1-2-4)3(10)5(7,8)9/h1-2H2 |
| InChIKey | GHUDLHCCINJZCJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.90 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|