C15H16ClN3O3S — CID 169090365
4-(benzenesulfonyl)-6-chloro-N-[[(3R)-oxolan-3-yl]methyl]pyridazin-3-amine (PubChem CID 169090365) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-6-chloro-N-[[(3R)-oxolan-3-yl]methyl]pyridazin-3-amine.
| Compound Name | 4-(benzenesulfonyl)-6-chloro-N-[[(3R)-oxolan-3-yl]methyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 169090365 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 4-(benzenesulfonyl)-6-chloro-N-[[(3R)-oxolan-3-yl]methyl]pyridazin-3-amine |
| SMILES | O=S(=O)(c1ccccc1)c1cc(Cl)nnc1NC[C@H]1CCOC1 |
| InChI | InChI=1S/C15H16ClN3O3S/c16-14-8-13(23(20,21)12-4-2-1-3-5-12)15(19-18-14)17-9-11-6-7-22-10-11/h1-5,8,11H,6-7,9-10H2,(H,17,19)/t11-/m1/s1 |
| InChIKey | PEICBZGPACWKLX-LLVKDONJSA-N |
| XLogP | 2.41 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |