C20H23FN4O — CID 169091641
7-[4-[3-[(6-fluoro-3-pyridinyl)oxy]propyl]piperazin-1-yl]-1H-indole (PubChem CID 169091641) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 7-[4-[3-[(6-fluoro-3-pyridinyl)oxy]propyl]piperazin-1-yl]-1H-indole.
| Compound Name | 7-[4-[3-[(6-fluoro-3-pyridinyl)oxy]propyl]piperazin-1-yl]-1H-indole |
|---|---|
| PubChem CID | 169091641 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 7-[4-[3-[(6-fluoro-3-pyridinyl)oxy]propyl]piperazin-1-yl]-1H-indole |
| SMILES | Fc1ccc(OCCCN2CCN(c3cccc4cc[nH]c34)CC2)cn1 |
| InChI | InChI=1S/C20H23FN4O/c21-19-6-5-17(15-23-19)26-14-2-9-24-10-12-25(13-11-24)18-4-1-3-16-7-8-22-20(16)18/h1,3-8,15,22H,2,9-14H2 |
| InChIKey | SPQSXSFULDCPMH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|