C28H36N4O — CID 23202041
1-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutan-1-one (PubChem CID 23202041) has the molecular formula C28H36N4O and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutan-1-one.
| Compound Name | 1-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 23202041 |
| Molecular Formula | C28H36N4O |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 1-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutan-1-one |
| SMILES | O=C(C(CCN1CCN(c2cccc3cc[nH]c23)CC1)c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C28H36N4O/c33-28(32-16-6-1-2-7-17-32)25(23-9-4-3-5-10-23)14-18-30-19-21-31(22-20-30)26-12-8-11-24-13-15-29-27(24)26/h3-5,8-13,15,25,29H,1-2,6-7,14,16-22H2 |
| InChIKey | IFXHXLQLYYOMMW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |