C26H36N2O2S — CID 57118187
(2S)-1-(azepan-1-yl)-4-[4-(3-methoxythiophen-2-yl)piperidin-1-yl]-2-phenylbutan-1-one (PubChem CID 57118187) has the molecular formula C26H36N2O2S and a molecular weight of 440.65 g/mol. Its IUPAC name is (2S)-1-(azepan-1-yl)-4-[4-(3-methoxythiophen-2-yl)piperidin-1-yl]-2-phenylbutan-1-one.
| Compound Name | (2S)-1-(azepan-1-yl)-4-[4-(3-methoxythiophen-2-yl)piperidin-1-yl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 57118187 |
| Molecular Formula | C26H36N2O2S |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (2S)-1-(azepan-1-yl)-4-[4-(3-methoxythiophen-2-yl)piperidin-1-yl]-2-phenylbutan-1-one |
| SMILES | COc1ccsc1C1CCN(CC[C@H](C(=O)N2CCCCCC2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H36N2O2S/c1-30-24-14-20-31-25(24)22-11-17-27(18-12-22)19-13-23(21-9-5-4-6-10-21)26(29)28-15-7-2-3-8-16-28/h4-6,9-10,14,20,22-23H,2-3,7-8,11-13,15-19H2,1H3/t23-/m0/s1 |
| InChIKey | SLADCMRDALIITQ-QHCPKHFHSA-N |
| XLogP | 5.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |