C28H37N3O — CID 22857192
4-[(4aR,9aS)-9-methyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]-1-(azepan-1-yl)-2-phenylbutan-1-one (PubChem CID 22857192) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is 4-[(4aR,9aS)-9-methyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]-1-(azepan-1-yl)-2-phenylbutan-1-one.
| Compound Name | 4-[(4aR,9aS)-9-methyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]-1-(azepan-1-yl)-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 22857192 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 4-[(4aR,9aS)-9-methyl-3,4,4a,9a-tetrahydro-1H-pyrido[3,4-b]indol-2-yl]-1-(azepan-1-yl)-2-phenylbutan-1-one |
| SMILES | CN1c2ccccc2[C@H]2CCN(CCC(C(=O)N3CCCCCC3)c3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C28H37N3O/c1-29-26-14-8-7-13-24(26)25-16-20-30(21-27(25)29)19-15-23(22-11-5-4-6-12-22)28(32)31-17-9-2-3-10-18-31/h4-8,11-14,23,25,27H,2-3,9-10,15-21H2,1H3/t23?,25-,27-/m1/s1 |
| InChIKey | CSBHMZKUUHZRLZ-APMJBHHHSA-N |
| XLogP | 4.87 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |