C28H36N4O — CID 57224565
4-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutanal (PubChem CID 57224565) has the molecular formula C28H36N4O and a molecular weight of 444.62 g/mol. Its IUPAC name is 4-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutanal.
| Compound Name | 4-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutanal |
|---|---|
| PubChem CID | 57224565 |
| Molecular Formula | C28H36N4O |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | 4-(azepan-1-yl)-4-[4-(1H-indol-7-yl)piperazin-1-yl]-2-phenylbutanal |
| SMILES | O=CC(CC(N1CCCCCC1)N1CCN(c2cccc3cc[nH]c23)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H36N4O/c33-22-25(23-9-4-3-5-10-23)21-27(31-15-6-1-2-7-16-31)32-19-17-30(18-20-32)26-12-8-11-24-13-14-29-28(24)26/h3-5,8-14,22,25,27,29H,1-2,6-7,15-21H2 |
| InChIKey | LHACNESBZWGMHB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|